C23H35N3O7S — CID 152565605
tert-butyl 4-[2-(1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-7-yl)oxyethyl]piperidine-1-carboxylate (PubChem CID 152565605) has the molecular formula C23H35N3O7S and a molecular weight of 497.61 g/mol. Its IUPAC name is tert-butyl 4-[2-(1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-7-yl)oxyethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-7-yl)oxyethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 152565605 |
| Molecular Formula | C23H35N3O7S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | tert-butyl 4-[2-(1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-7-yl)oxyethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCOc2ccc3c(n2)OC2(CCOCC2)CNS3(=O)=O)CC1 |
| InChI | InChI=1S/C23H35N3O7S/c1-22(2,3)33-21(27)26-11-6-17(7-12-26)8-13-31-19-5-4-18-20(25-19)32-23(9-14-30-15-10-23)16-24-34(18,28)29/h4-5,17,24H,6-16H2,1-3H3 |
| InChIKey | YQKKAKFSUZJPSU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |