C15H19N3O6 — CID 175234203
1-O-tert-butyl 3-O-(2-nitro-3-pyridinyl) 3-methylazetidine-1,3-dicarboxylate (PubChem CID 175234203) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-(2-nitro-3-pyridinyl) 3-methylazetidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-(2-nitro-3-pyridinyl) 3-methylazetidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175234203 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-O-tert-butyl 3-O-(2-nitro-3-pyridinyl) 3-methylazetidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(C(=O)Oc2cccnc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H19N3O6/c1-14(2,3)24-13(20)17-8-15(4,9-17)12(19)23-10-6-5-7-16-11(10)18(21)22/h5-7H,8-9H2,1-4H3 |
| InChIKey | JECJTLVXZCWJIR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|