C11H18O3 — CID 146401048
3-cyclobutyl-1-(1,3-dioxan-2-yl)propan-1-one (PubChem CID 146401048) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 3-cyclobutyl-1-(1,3-dioxan-2-yl)propan-1-one.
| Compound Name | 3-cyclobutyl-1-(1,3-dioxan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 146401048 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 3-cyclobutyl-1-(1,3-dioxan-2-yl)propan-1-one |
| SMILES | O=C(CCC1CCC1)C1OCCCO1 |
| InChI | InChI=1S/C11H18O3/c12-10(6-5-9-3-1-4-9)11-13-7-2-8-14-11/h9,11H,1-8H2 |
| InChIKey | WCNWCMFRVWRPMF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |