C21H22FN3O7S — CID 146403122
N-[2-[(1R)-1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]-7-fluoro-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 146403122) has the molecular formula C21H22FN3O7S and a molecular weight of 479.49 g/mol. Its IUPAC name is N-[2-[(1R)-1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]-7-fluoro-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | N-[2-[(1R)-1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]-7-fluoro-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 146403122 |
| Molecular Formula | C21H22FN3O7S |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-[2-[(1R)-1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]-7-fluoro-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | CCOc1nc([C@H](CS(C)(=O)=O)N2C(=O)c3c(F)ccc(NC(C)=O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C21H22FN3O7S/c1-5-32-19-16(31-3)9-8-13(24-19)15(10-33(4,29)30)25-20(27)17-12(22)6-7-14(23-11(2)26)18(17)21(25)28/h6-9,15H,5,10H2,1-4H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | JWXUNLIXXYNEIY-HNNXBMFYSA-N |
| XLogP | 1.97 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|