C21H23N3O8S — CID 146403193
N-[2-[(1S)-1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]-2-hydroxyacetamide (PubChem CID 146403193) has the molecular formula C21H23N3O8S and a molecular weight of 477.50 g/mol. Its IUPAC name is N-[2-[(1S)-1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]-2-hydroxyacetamide.
| Compound Name | N-[2-[(1S)-1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 146403193 |
| Molecular Formula | C21H23N3O8S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-[2-[(1S)-1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]-2-hydroxyacetamide |
| SMILES | CCOc1nc([C@@H](CS(C)(=O)=O)N2C(=O)c3cccc(NC(=O)CO)c3C2=O)ccc1OC |
| InChI | InChI=1S/C21H23N3O8S/c1-4-32-19-16(31-2)9-8-13(23-19)15(11-33(3,29)30)24-20(27)12-6-5-7-14(18(12)21(24)28)22-17(26)10-25/h5-9,15,25H,4,10-11H2,1-3H3,(H,22,26)/t15-/m1/s1 |
| InChIKey | AZLQMFBTPGPZOX-OAHLLOKOSA-N |
| XLogP | 0.80 |
| TPSA | 152.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|