C25H18F4N4O2 — CID 146403974
6-(3-amino-2-fluorophenyl)-8-benzyl-2-[[5-(trifluoromethyl)furan-2-yl]methyl]imidazo[1,2-a]pyrazin-3-ol (PubChem CID 146403974) has the molecular formula C25H18F4N4O2 and a molecular weight of 482.44 g/mol. Its IUPAC name is 6-(3-amino-2-fluorophenyl)-8-benzyl-2-[[5-(trifluoromethyl)furan-2-yl]methyl]imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-(3-amino-2-fluorophenyl)-8-benzyl-2-[[5-(trifluoromethyl)furan-2-yl]methyl]imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 146403974 |
| Molecular Formula | C25H18F4N4O2 |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 6-(3-amino-2-fluorophenyl)-8-benzyl-2-[[5-(trifluoromethyl)furan-2-yl]methyl]imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Nc1cccc(-c2cn3c(O)c(Cc4ccc(C(F)(F)F)o4)nc3c(Cc3ccccc3)n2)c1F |
| InChI | InChI=1S/C25H18F4N4O2/c26-22-16(7-4-8-17(22)30)20-13-33-23(18(31-20)11-14-5-2-1-3-6-14)32-19(24(33)34)12-15-9-10-21(35-15)25(27,28)29/h1-10,13,34H,11-12,30H2 |
| InChIKey | WVPOJZZRZHVRDV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|