C24H17FN4O4 — CID 146404016
8-benzyl-6-(2-fluoro-3-nitrophenyl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 146404016) has the molecular formula C24H17FN4O4 and a molecular weight of 444.42 g/mol. Its IUPAC name is 8-benzyl-6-(2-fluoro-3-nitrophenyl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 8-benzyl-6-(2-fluoro-3-nitrophenyl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 146404016 |
| Molecular Formula | C24H17FN4O4 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 8-benzyl-6-(2-fluoro-3-nitrophenyl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | O=[N+]([O-])c1cccc(-c2cn3c(O)c(Cc4ccco4)nc3c(Cc3ccccc3)n2)c1F |
| InChI | InChI=1S/C24H17FN4O4/c25-22-17(9-4-10-21(22)29(31)32)20-14-28-23(18(26-20)12-15-6-2-1-3-7-15)27-19(24(28)30)13-16-8-5-11-33-16/h1-11,14,30H,12-13H2 |
| InChIKey | DYHTWILZTUSSJW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|