C30H32FN3O3Si — CID 146673720
8-benzyl-6-[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 146673720) has the molecular formula C30H32FN3O3Si and a molecular weight of 529.69 g/mol. Its IUPAC name is 8-benzyl-6-[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 8-benzyl-6-[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 146673720 |
| Molecular Formula | C30H32FN3O3Si |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 8-benzyl-6-[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(-c2cn3c(O)c(Cc4ccco4)nc3c(Cc3ccccc3)n2)c1F |
| InChI | InChI=1S/C30H32FN3O3Si/c1-30(2,3)38(4,5)37-26-15-9-14-22(27(26)31)25-19-34-28(23(32-25)17-20-11-7-6-8-12-20)33-24(29(34)35)18-21-13-10-16-36-21/h6-16,19,35H,17-18H2,1-5H3 |
| InChIKey | ZTGWSLSDAFDDGX-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 72.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|