C24H17F3N4O2 — CID 146403986
6-(3-amino-2-fluorophenyl)-8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 146403986) has the molecular formula C24H17F3N4O2 and a molecular weight of 450.42 g/mol. Its IUPAC name is 6-(3-amino-2-fluorophenyl)-8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-(3-amino-2-fluorophenyl)-8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 146403986 |
| Molecular Formula | C24H17F3N4O2 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 6-(3-amino-2-fluorophenyl)-8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Nc1cccc(-c2cn3c(O)c(Cc4ccco4)nc3c(Cc3c(F)cccc3F)n2)c1F |
| InChI | InChI=1S/C24H17F3N4O2/c25-16-6-2-7-17(26)15(16)11-19-23-30-20(10-13-4-3-9-33-13)24(32)31(23)12-21(29-19)14-5-1-8-18(28)22(14)27/h1-9,12,32H,10-11,28H2 |
| InChIKey | IVZTUVXMRZENRF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|