C26H30BrClN2O2 — CID 146404152
4-[(2S)-2-bromo-4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzoic acid (PubChem CID 146404152) has the molecular formula C26H30BrClN2O2 and a molecular weight of 517.90 g/mol. Its IUPAC name is 4-[(2S)-2-bromo-4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[(2S)-2-bromo-4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 146404152 |
| Molecular Formula | C26H30BrClN2O2 |
| Molecular Weight | 517.90 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 4-[(2S)-2-bromo-4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzoic acid |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(C(=O)O)cc3)[C@@H](Br)C2)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H30BrClN2O2/c1-26(2)12-11-20(23(15-26)18-3-7-21(28)8-4-18)16-29-13-14-30(24(27)17-29)22-9-5-19(6-10-22)25(31)32/h3-10,24H,11-17H2,1-2H3,(H,31,32)/t24-/m1/s1 |
| InChIKey | KKRKWJBXDVDRQR-XMMPIXPASA-N |
| XLogP | 6.55 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.90 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|