C25H30ClN2O2S- — CID 166818013
4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzenesulfinate (PubChem CID 166818013) has the molecular formula C25H30ClN2O2S- and a molecular weight of 458.05 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzenesulfinate.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzenesulfinate |
|---|---|
| PubChem CID | 166818013 |
| Molecular Formula | C25H30ClN2O2S- |
| Molecular Weight | 458.05 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzenesulfinate |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(S(=O)[O-])cc3)CC2)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H31ClN2O2S/c1-25(2)12-11-20(24(17-25)19-3-5-21(26)6-4-19)18-27-13-15-28(16-14-27)22-7-9-23(10-8-22)31(29)30/h3-10H,11-18H2,1-2H3,(H,29,30)/p-1 |
| InChIKey | OFVYUSDZGAMISL-UHFFFAOYSA-M |
| XLogP | 5.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.05 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|