C23H27N3O6S2 — CID 146405663
1,3-bis[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 146405663) has the molecular formula C23H27N3O6S2 and a molecular weight of 505.62 g/mol. Its IUPAC name is 1,3-bis[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1,3-bis[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 146405663 |
| Molecular Formula | C23H27N3O6S2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 1,3-bis[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CS(=O)(=O)c1ccc(CN2C(=O)N(Cc3ccc(S(C)(=O)=O)cc3)C3(CCNCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O6S2/c1-33(29,30)19-7-3-17(4-8-19)15-25-21(27)23(11-13-24-14-12-23)26(22(25)28)16-18-5-9-20(10-6-18)34(2,31)32/h3-10,24H,11-16H2,1-2H3 |
| InChIKey | LITGOOGUZLCKLN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|