C24H18ClF4N3O2 — CID 146407334
5-[5-chloro-4-[2-methoxy-4-[(1S)-1-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]-1H-imidazol-2-yl]-2-fluoropyridine (PubChem CID 146407334) has the molecular formula C24H18ClF4N3O2 and a molecular weight of 491.87 g/mol. Its IUPAC name is 5-[5-chloro-4-[2-methoxy-4-[(1S)-1-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]-1H-imidazol-2-yl]-2-fluoropyridine.
| Compound Name | 5-[5-chloro-4-[2-methoxy-4-[(1S)-1-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]-1H-imidazol-2-yl]-2-fluoropyridine |
|---|---|
| PubChem CID | 146407334 |
| Molecular Formula | C24H18ClF4N3O2 |
| Molecular Weight | 491.87 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 5-[5-chloro-4-[2-methoxy-4-[(1S)-1-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]-1H-imidazol-2-yl]-2-fluoropyridine |
| SMILES | COc1cc(O[C@@H](C)c2ccc(C(F)(F)F)cc2)ccc1-c1nc(-c2ccc(F)nc2)[nH]c1Cl |
| InChI | InChI=1S/C24H18ClF4N3O2/c1-13(14-3-6-16(7-4-14)24(27,28)29)34-17-8-9-18(19(11-17)33-2)21-22(25)32-23(31-21)15-5-10-20(26)30-12-15/h3-13H,1-2H3,(H,31,32)/t13-/m0/s1 |
| InChIKey | VXFZTESUERIPOP-ZDUSSCGKSA-N |
| XLogP | 7.10 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.87 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|