C23H18F4N4O2 — CID 146407295
2-fluoro-5-[5-[2-methoxy-4-[(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]ethoxy]phenyl]-1H-imidazol-2-yl]pyridine (PubChem CID 146407295) has the molecular formula C23H18F4N4O2 and a molecular weight of 458.42 g/mol. Its IUPAC name is 2-fluoro-5-[5-[2-methoxy-4-[(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]ethoxy]phenyl]-1H-imidazol-2-yl]pyridine.
| Compound Name | 2-fluoro-5-[5-[2-methoxy-4-[(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]ethoxy]phenyl]-1H-imidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 146407295 |
| Molecular Formula | C23H18F4N4O2 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-fluoro-5-[5-[2-methoxy-4-[(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]ethoxy]phenyl]-1H-imidazol-2-yl]pyridine |
| SMILES | COc1cc(O[C@H](C)c2ccc(C(F)(F)F)nc2)ccc1-c1cnc(-c2ccc(F)nc2)[nH]1 |
| InChI | InChI=1S/C23H18F4N4O2/c1-13(14-3-7-20(28-10-14)23(25,26)27)33-16-5-6-17(19(9-16)32-2)18-12-30-22(31-18)15-4-8-21(24)29-11-15/h3-13H,1-2H3,(H,30,31)/t13-/m1/s1 |
| InChIKey | HTNQIISPUKSJRM-CYBMUJFWSA-N |
| XLogP | 5.84 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|