C21H18FN5O2 — CID 129304112
2-[[4-[2-(6-fluoro-3-pyridinyl)-1H-imidazol-5-yl]-3-methoxyphenoxy]methyl]-5-methylpyrazine (PubChem CID 129304112) has the molecular formula C21H18FN5O2 and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-[[4-[2-(6-fluoro-3-pyridinyl)-1H-imidazol-5-yl]-3-methoxyphenoxy]methyl]-5-methylpyrazine.
| Compound Name | 2-[[4-[2-(6-fluoro-3-pyridinyl)-1H-imidazol-5-yl]-3-methoxyphenoxy]methyl]-5-methylpyrazine |
|---|---|
| PubChem CID | 129304112 |
| Molecular Formula | C21H18FN5O2 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[[4-[2-(6-fluoro-3-pyridinyl)-1H-imidazol-5-yl]-3-methoxyphenoxy]methyl]-5-methylpyrazine |
| SMILES | COc1cc(OCc2cnc(C)cn2)ccc1-c1cnc(-c2ccc(F)nc2)[nH]1 |
| InChI | InChI=1S/C21H18FN5O2/c1-13-8-24-15(10-23-13)12-29-16-4-5-17(19(7-16)28-2)18-11-26-21(27-18)14-3-6-20(22)25-9-14/h3-11H,12H2,1-2H3,(H,26,27) |
| InChIKey | VWZKYOUNJMOJBT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|