C12H28O2Si2 — CID 14640995
1-[methoxy(dimethyl)silyl]-3,3-dimethyl-1-trimethylsilylbutan-2-one (PubChem CID 14640995) has the molecular formula C12H28O2Si2 and a molecular weight of 260.53 g/mol. Its IUPAC name is 1-[methoxy(dimethyl)silyl]-3,3-dimethyl-1-trimethylsilylbutan-2-one.
| Compound Name | 1-[methoxy(dimethyl)silyl]-3,3-dimethyl-1-trimethylsilylbutan-2-one |
|---|---|
| PubChem CID | 14640995 |
| Molecular Formula | C12H28O2Si2 |
| Molecular Weight | 260.53 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-[methoxy(dimethyl)silyl]-3,3-dimethyl-1-trimethylsilylbutan-2-one |
| SMILES | CO[Si](C)(C)C(C(=O)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H28O2Si2/c1-12(2,3)10(13)11(15(5,6)7)16(8,9)14-4/h11H,1-9H3 |
| InChIKey | BOLBSVXRBZUDIQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|