C12H26O2Si — CID 12008020
3,3-dimethyl-4-triethylsilyloxybutan-2-one (PubChem CID 12008020) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is 3,3-dimethyl-4-triethylsilyloxybutan-2-one.
| Compound Name | 3,3-dimethyl-4-triethylsilyloxybutan-2-one |
|---|---|
| PubChem CID | 12008020 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3,3-dimethyl-4-triethylsilyloxybutan-2-one |
| SMILES | CC[Si](CC)(CC)OCC(C)(C)C(C)=O |
| InChI | InChI=1S/C12H26O2Si/c1-7-15(8-2,9-3)14-10-12(5,6)11(4)13/h7-10H2,1-6H3 |
| InChIKey | ZGYPSVOSXVTXDJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|