C12H28O3Si2 — CID 91696622
3,3-dimethyl-1,4-bis(trimethylsilyloxy)butan-2-one (PubChem CID 91696622) has the molecular formula C12H28O3Si2 and a molecular weight of 276.52 g/mol. Its IUPAC name is 3,3-dimethyl-1,4-bis(trimethylsilyloxy)butan-2-one.
| Compound Name | 3,3-dimethyl-1,4-bis(trimethylsilyloxy)butan-2-one |
|---|---|
| PubChem CID | 91696622 |
| Molecular Formula | C12H28O3Si2 |
| Molecular Weight | 276.52 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3,3-dimethyl-1,4-bis(trimethylsilyloxy)butan-2-one |
| SMILES | CC(C)(CO[Si](C)(C)C)C(=O)CO[Si](C)(C)C |
| InChI | InChI=1S/C12H28O3Si2/c1-12(2,10-15-17(6,7)8)11(13)9-14-16(3,4)5/h9-10H2,1-8H3 |
| InChIKey | YUIJADYAZOZZRN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|