C16H12N2O5 — CID 14641112
dimethyl 5-oxo-6H-benzo[f][1,7]naphthyridine-2,3-dicarboxylate (PubChem CID 14641112) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is dimethyl 5-oxo-6H-benzo[f][1,7]naphthyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 5-oxo-6H-benzo[f][1,7]naphthyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 14641112 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | dimethyl 5-oxo-6H-benzo[f][1,7]naphthyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc2c(nc1C(=O)OC)c(=O)[nH]c1ccccc12 |
| InChI | InChI=1S/C16H12N2O5/c1-22-15(20)10-7-9-8-5-3-4-6-11(8)17-14(19)12(9)18-13(10)16(21)23-2/h3-7H,1-2H3,(H,17,19) |
| InChIKey | ZQAUEYUVRVBERK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|