C22H22N6OS2 — CID 146412658
N-[5-[7-[(1R)-1-(1,3-benzothiazol-5-yl)ethyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 146412658) has the molecular formula C22H22N6OS2 and a molecular weight of 450.59 g/mol. Its IUPAC name is N-[5-[7-[(1R)-1-(1,3-benzothiazol-5-yl)ethyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[7-[(1R)-1-(1,3-benzothiazol-5-yl)ethyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 146412658 |
| Molecular Formula | C22H22N6OS2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-[5-[7-[(1R)-1-(1,3-benzothiazol-5-yl)ethyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(-c2cnc3c(c2)CCN([C@H](C)c2ccc4scnc4c2)CC3)s1 |
| InChI | InChI=1S/C22H22N6OS2/c1-13(15-3-4-20-19(10-15)24-12-30-20)28-7-5-16-9-17(11-23-18(16)6-8-28)21-26-27-22(31-21)25-14(2)29/h3-4,9-13H,5-8H2,1-2H3,(H,25,27,29)/t13-/m1/s1 |
| InChIKey | ZJVXUCXRGAAVCS-CYBMUJFWSA-N |
| XLogP | 4.33 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |