C11H12N4S — CID 146412963
9-thia-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-12-carbonitrile (PubChem CID 146412963) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 9-thia-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-12-carbonitrile.
| Compound Name | 9-thia-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-12-carbonitrile |
|---|---|
| PubChem CID | 146412963 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 9-thia-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-12-carbonitrile |
| SMILES | N#Cc1cnc2c(c1)SNCC1CCCN21 |
| InChI | InChI=1S/C11H12N4S/c12-5-8-4-10-11(13-6-8)15-3-1-2-9(15)7-14-16-10/h4,6,9,14H,1-3,7H2 |
| InChIKey | JMOUBWYGZZIMGP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|