C16H24FNO — CID 146414995
[(4R,6R)-6-methyloct-7-en-4-yl] (2E,4Z)-2-fluorohepta-2,4,6-trienimidate (PubChem CID 146414995) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is [(4R,6R)-6-methyloct-7-en-4-yl] (2E,4Z)-2-fluorohepta-2,4,6-trienimidate.
| Compound Name | [(4R,6R)-6-methyloct-7-en-4-yl] (2E,4Z)-2-fluorohepta-2,4,6-trienimidate |
|---|---|
| PubChem CID | 146414995 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | [(4R,6R)-6-methyloct-7-en-4-yl] (2E,4Z)-2-fluorohepta-2,4,6-trienimidate |
| SMILES | [H]/N=C(O[C@H](CCC)C[C@@H](C)C=C)\C(F)=C/C=C\C=C |
| InChI | InChI=1S/C16H24FNO/c1-5-8-9-11-15(17)16(18)19-14(10-6-2)12-13(4)7-3/h5,7-9,11,13-14,18H,1,3,6,10,12H2,2,4H3/b9-8-,15-11+,18-16+/t13-,14+/m0/s1 |
| InChIKey | SOCQMTCYYVQBAY-FOTDCXOZSA-N |
| XLogP | 4.96 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|