C22H21FN4O2S — CID 146415366
8-[1-(1,3-benzothiazol-5-yl)ethyl]-3-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 146415366) has the molecular formula C22H21FN4O2S and a molecular weight of 424.50 g/mol. Its IUPAC name is 8-[1-(1,3-benzothiazol-5-yl)ethyl]-3-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[1-(1,3-benzothiazol-5-yl)ethyl]-3-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 146415366 |
| Molecular Formula | C22H21FN4O2S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 8-[1-(1,3-benzothiazol-5-yl)ethyl]-3-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(c1ccc2scnc2c1)N1CCC2(CC1)NC(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C22H21FN4O2S/c1-14(15-2-7-19-18(12-15)24-13-30-19)26-10-8-22(9-11-26)20(28)27(21(29)25-22)17-5-3-16(23)4-6-17/h2-7,12-14H,8-11H2,1H3,(H,25,29) |
| InChIKey | VXRQAHLDZZWABB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|