C16H10ClNO2S — CID 14641692
1-(2-chlorophenyl)-3-phenylsulfanylpyrrole-2,5-dione (PubChem CID 14641692) has the molecular formula C16H10ClNO2S and a molecular weight of 315.78 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-phenylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-(2-chlorophenyl)-3-phenylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 14641692 |
| Molecular Formula | C16H10ClNO2S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 1-(2-chlorophenyl)-3-phenylsulfanylpyrrole-2,5-dione |
| SMILES | O=C1C=C(Sc2ccccc2)C(=O)N1c1ccccc1Cl |
| InChI | InChI=1S/C16H10ClNO2S/c17-12-8-4-5-9-13(12)18-15(19)10-14(16(18)20)21-11-6-2-1-3-7-11/h1-10H |
| InChIKey | RXADYSFRRBXVKS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_imide_A(1)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|