C14H12Br2ClNO2 — CID 7115541
(3aR,5R,6S,7aR)-5,6-dibromo-2-(2-chlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 7115541) has the molecular formula C14H12Br2ClNO2 and a molecular weight of 421.52 g/mol. Its IUPAC name is (3aR,5R,6S,7aR)-5,6-dibromo-2-(2-chlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,5R,6S,7aR)-5,6-dibromo-2-(2-chlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7115541 |
| Molecular Formula | C14H12Br2ClNO2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 418.89 |
| IUPAC Name | (3aR,5R,6S,7aR)-5,6-dibromo-2-(2-chlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2C[C@@H](Br)[C@@H](Br)C[C@H]2C(=O)N1c1ccccc1Cl |
| InChI | InChI=1S/C14H12Br2ClNO2/c15-9-5-7-8(6-10(9)16)14(20)18(13(7)19)12-4-2-1-3-11(12)17/h1-4,7-10H,5-6H2/t7-,8-,9-,10+/m1/s1 |
| InChIKey | SQKFRZAEOHSRQJ-KYXWUPHJSA-N |
| XLogP | 3.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|