C14H11Br2Cl2NO2 — CID 98338104
(3aR,5S,6S,7aR)-5,6-dibromo-2-(2,3-dichlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 98338104) has the molecular formula C14H11Br2Cl2NO2 and a molecular weight of 455.96 g/mol. Its IUPAC name is (3aR,5S,6S,7aR)-5,6-dibromo-2-(2,3-dichlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,5S,6S,7aR)-5,6-dibromo-2-(2,3-dichlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98338104 |
| Molecular Formula | C14H11Br2Cl2NO2 |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 452.85 |
| IUPAC Name | (3aR,5S,6S,7aR)-5,6-dibromo-2-(2,3-dichlorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2C[C@H](Br)[C@@H](Br)C[C@H]2C(=O)N1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H11Br2Cl2NO2/c15-8-4-6-7(5-9(8)16)14(21)19(13(6)20)11-3-1-2-10(17)12(11)18/h1-3,6-9H,4-5H2/t6-,7-,8+,9+/m1/s1 |
| InChIKey | GCOJTIVEHJUDIQ-HXFLIBJXSA-N |
| XLogP | 4.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|