C15H5Cl8NO2 — CID 99950994
(1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-(2,3-dichlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 99950994) has the molecular formula C15H5Cl8NO2 and a molecular weight of 514.83 g/mol. Its IUPAC name is (1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-(2,3-dichlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-(2,3-dichlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 99950994 |
| Molecular Formula | C15H5Cl8NO2 |
| Molecular Weight | 514.83 g/mol |
| Exact Mass | 510.78 |
| IUPAC Name | (1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-(2,3-dichlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1cccc(Cl)c1Cl)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C15H5Cl8NO2/c16-4-2-1-3-5(8(4)17)24-11(25)6-7(12(24)26)14(21)10(19)9(18)13(6,20)15(14,22)23/h1-3,6-7H/t6-,7-,13+,14+/m0/s1 |
| InChIKey | GFEIQBZIANYENY-CCBCZWRWSA-N |
| XLogP | 5.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.83 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|