C14H12Br2ClNO3 — CID 100807758
(3aS,5S,6R,7aR)-5,6-dibromo-2-(5-chloro-2-hydroxyphenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 100807758) has the molecular formula C14H12Br2ClNO3 and a molecular weight of 437.52 g/mol. Its IUPAC name is (3aS,5S,6R,7aR)-5,6-dibromo-2-(5-chloro-2-hydroxyphenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,5S,6R,7aR)-5,6-dibromo-2-(5-chloro-2-hydroxyphenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 100807758 |
| Molecular Formula | C14H12Br2ClNO3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 434.89 |
| IUPAC Name | (3aS,5S,6R,7aR)-5,6-dibromo-2-(5-chloro-2-hydroxyphenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2C[C@H](Br)[C@H](Br)C[C@H]2C(=O)N1c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H12Br2ClNO3/c15-9-4-7-8(5-10(9)16)14(21)18(13(7)20)11-3-6(17)1-2-12(11)19/h1-3,7-10,19H,4-5H2/t7-,8+,9-,10+ |
| InChIKey | OKBLNMWQLLPRLT-YNFQOJQRSA-N |
| XLogP | 3.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|