C11H10BrFO3 — CID 146417198
1-(2-bromo-4-fluorophenyl)-5-hydroxypentane-1,4-dione (PubChem CID 146417198) has the molecular formula C11H10BrFO3 and a molecular weight of 289.10 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-5-hydroxypentane-1,4-dione.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-5-hydroxypentane-1,4-dione |
|---|---|
| PubChem CID | 146417198 |
| Molecular Formula | C11H10BrFO3 |
| Molecular Weight | 289.10 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-5-hydroxypentane-1,4-dione |
| SMILES | O=C(CO)CCC(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H10BrFO3/c12-10-5-7(13)1-3-9(10)11(16)4-2-8(15)6-14/h1,3,5,14H,2,4,6H2 |
| InChIKey | CNIJBRZPRSAXOE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.10 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |