C11H11BrO3 — CID 125478285
1-(2-bromophenyl)-5-hydroxypentane-1,4-dione (PubChem CID 125478285) has the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. Its IUPAC name is 1-(2-bromophenyl)-5-hydroxypentane-1,4-dione.
| Compound Name | 1-(2-bromophenyl)-5-hydroxypentane-1,4-dione |
|---|---|
| PubChem CID | 125478285 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 1-(2-bromophenyl)-5-hydroxypentane-1,4-dione |
| SMILES | O=C(CO)CCC(=O)c1ccccc1Br |
| InChI | InChI=1S/C11H11BrO3/c12-10-4-2-1-3-9(10)11(15)6-5-8(14)7-13/h1-4,13H,5-7H2 |
| InChIKey | YMCKTHYZQGHEHY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |