C13H15BrO2 — CID 28896266
1-(2-bromophenyl)-4,4-dimethylpentane-1,3-dione (PubChem CID 28896266) has the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. Its IUPAC name is 1-(2-bromophenyl)-4,4-dimethylpentane-1,3-dione.
| Compound Name | 1-(2-bromophenyl)-4,4-dimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 28896266 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-(2-bromophenyl)-4,4-dimethylpentane-1,3-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)c1ccccc1Br |
| InChI | InChI=1S/C13H15BrO2/c1-13(2,3)12(16)8-11(15)9-6-4-5-7-10(9)14/h4-7H,8H2,1-3H3 |
| InChIKey | YHOIBJZFSULTIX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|