C30H42N4O4 — CID 146417392
2-[6-cyclopropyl-4-(propan-2-yloxymethyl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417392) has the molecular formula C30H42N4O4 and a molecular weight of 522.69 g/mol. Its IUPAC name is 2-[6-cyclopropyl-4-(propan-2-yloxymethyl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[6-cyclopropyl-4-(propan-2-yloxymethyl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417392 |
| Molecular Formula | C30H42N4O4 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 2-[6-cyclopropyl-4-(propan-2-yloxymethyl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | CC(C)OCc1cc(C2CC2)ncc1C(C(=O)O)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C30H42N4O4/c1-20(2)38-19-23-16-27(21-8-9-21)32-17-26(23)28(30(35)36)34-14-12-25(18-34)37-15-4-3-7-24-11-10-22-6-5-13-31-29(22)33-24/h10-11,16-17,20-21,25,28H,3-9,12-15,18-19H2,1-2H3,(H,31,33)(H,35,36)/t25-,28?/m1/s1 |
| InChIKey | VKUSNJJMFBSWGB-RXVAYIKUSA-N |
| XLogP | 4.88 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|