C11H10BrFO2 — CID 146417524
6-(2-bromo-4-fluorophenyl)oxan-3-one (PubChem CID 146417524) has the molecular formula C11H10BrFO2 and a molecular weight of 273.10 g/mol. Its IUPAC name is 6-(2-bromo-4-fluorophenyl)oxan-3-one.
| Compound Name | 6-(2-bromo-4-fluorophenyl)oxan-3-one |
|---|---|
| PubChem CID | 146417524 |
| Molecular Formula | C11H10BrFO2 |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 6-(2-bromo-4-fluorophenyl)oxan-3-one |
| SMILES | O=C1CCC(c2ccc(F)cc2Br)OC1 |
| InChI | InChI=1S/C11H10BrFO2/c12-10-5-7(13)1-3-9(10)11-4-2-8(14)6-15-11/h1,3,5,11H,2,4,6H2 |
| InChIKey | HMRNZEAXTWGOOY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |