C12H14BrFO2 — CID 131844936
2-(2-bromo-4-fluorophenyl)-5,5-dimethyl-1,3-dioxane (PubChem CID 131844936) has the molecular formula C12H14BrFO2 and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 131844936 |
| Molecular Formula | C12H14BrFO2 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-5,5-dimethyl-1,3-dioxane |
| SMILES | CC1(C)COC(c2ccc(F)cc2Br)OC1 |
| InChI | InChI=1S/C12H14BrFO2/c1-12(2)6-15-11(16-7-12)9-4-3-8(14)5-10(9)13/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | CXKVZWLZBMDXQG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |