C24H28N6O2 — CID 146418360
1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)phenyl]-1-(2-pyrrolidin-1-ylethanimidoyl)urea (PubChem CID 146418360) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)phenyl]-1-(2-pyrrolidin-1-ylethanimidoyl)urea.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)phenyl]-1-(2-pyrrolidin-1-ylethanimidoyl)urea |
|---|---|
| PubChem CID | 146418360 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)phenyl]-1-(2-pyrrolidin-1-ylethanimidoyl)urea |
| SMILES | [H]/N=C(\CN1CCCC1)N(Cc1cccc(OC)c1)C(=O)Nc1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C24H28N6O2/c1-32-22-6-4-5-18(13-22)16-30(23(25)17-29-11-2-3-12-29)24(31)28-21-9-7-19(8-10-21)20-14-26-27-15-20/h4-10,13-15,25H,2-3,11-12,16-17H2,1H3,(H,26,27)(H,28,31)/b25-23+ |
| InChIKey | YEBUNOPAZDUUJA-WJTDDFOZSA-N |
| XLogP | 4.19 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|