C24H23N5O2 — CID 146418275
1-ethanimidoyl-1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]urea (PubChem CID 146418275) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-ethanimidoyl-1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]urea.
| Compound Name | 1-ethanimidoyl-1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 146418275 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-ethanimidoyl-1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]urea |
| SMILES | [H]/N=C(\C)N(Cc1cccc(OC)c1)C(=O)Nc1ccc(-c2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C24H23N5O2/c1-16(25)29(15-17-4-3-5-20(14-17)31-2)24(30)28-19-8-6-18(7-9-19)21-10-12-26-23-22(21)11-13-27-23/h3-14,25H,15H2,1-2H3,(H,26,27)(H,28,30)/b25-16+ |
| InChIKey | YTURCOYRMRTHNH-PCLIKHOPSA-N |
| XLogP | 5.27 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|