C21H19N5O2 — CID 91253503
1-[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 91253503) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 91253503 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CNC(=O)Nc2ccc(-c3ccnc4nc[nH]c34)cc2)c1 |
| InChI | InChI=1S/C21H19N5O2/c1-28-17-4-2-3-14(11-17)12-23-21(27)26-16-7-5-15(6-8-16)18-9-10-22-20-19(18)24-13-25-20/h2-11,13H,12H2,1H3,(H,22,24,25)(H2,23,26,27) |
| InChIKey | AJYJJGNWHALZBC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |