About (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine
(2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine (PubChem CID 146419466) has the molecular formula C25H25NO
and a molecular weight of 355.48 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine.
Molecular Properties
| Compound Name | (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine |
| PubChem CID | 146419466 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine |
| SMILES | c1ccc(-c2ccc(CN3CCC[C@H]3c3ccc4c(c3)OCC4)cc2)cc1 |
| InChI | InChI=1S/C25H25NO/c1-2-5-20(6-3-1)21-10-8-19(9-11-21)18-26-15-4-7-24(26)23-13-12-22-14-16-27-25(22)17-23/h1-3,5-6,8-13,17,24H,4,7,14-16,18H2/t24-/m0/s1 |
| InChIKey | LEAYQZAJRITCTC-DEOSSOPVSA-N |
| XLogP | 5.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine?
The IUPAC name of (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine (CID 146419466) is (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine.
What is the SMILES notation for (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine?
The canonical SMILES for (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine is c1ccc(-c2ccc(CN3CCC[C@H]3c3ccc4c(c3)OCC4)cc2)cc1.
What is the InChIKey of (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine?
The InChIKey is LEAYQZAJRITCTC-DEOSSOPVSA-N. The full InChI is InChI=1S/C25H25NO/c1-2-5-20(6-3-1)21-10-8-19(9-11-21)18-26-15-4-7-24(26)23-13-12-22-14-16-27-25(22)17-23/h1-3,5-6,8-13,17,24H,4,7,14-16,18H2/t24-/m0/s1.
What are the key properties of (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine?
(2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine has a molecular weight of 355.48 g/mol, XLogP of 5.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-1-[(4-phenylphenyl)methyl]pyrrolidine is sourced from PubChem (CID 146419466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).