About benzamide;(4-tert-butyl-2-phenylphenyl) benzoate
benzamide;(4-tert-butyl-2-phenylphenyl) benzoate (PubChem CID 146420990) has the molecular formula C30H29NO3
and a molecular weight of 451.57 g/mol. Its IUPAC name is benzamide;(4-tert-butyl-2-phenylphenyl) benzoate.
Molecular Properties
| Compound Name | benzamide;(4-tert-butyl-2-phenylphenyl) benzoate |
| PubChem CID | 146420990 |
| Molecular Formula | C30H29NO3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | benzamide;(4-tert-butyl-2-phenylphenyl) benzoate |
| SMILES | CC(C)(C)c1ccc(OC(=O)c2ccccc2)c(-c2ccccc2)c1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H22O2.C7H7NO/c1-23(2,3)19-14-15-21(20(16-19)17-10-6-4-7-11-17)25-22(24)18-12-8-5-9-13-18;8-7(9)6-4-2-1-3-5-6/h4-16H,1-3H3;1-5H,(H2,8,9) |
| InChIKey | ZDTXQOSQGGJFOG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze benzamide;(4-tert-butyl-2-phenylphenyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;(4-tert-butyl-2-phenylphenyl) benzoate?
The IUPAC name of benzamide;(4-tert-butyl-2-phenylphenyl) benzoate (CID 146420990) is benzamide;(4-tert-butyl-2-phenylphenyl) benzoate.
What is the SMILES notation for benzamide;(4-tert-butyl-2-phenylphenyl) benzoate?
The canonical SMILES for benzamide;(4-tert-butyl-2-phenylphenyl) benzoate is CC(C)(C)c1ccc(OC(=O)c2ccccc2)c(-c2ccccc2)c1.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;(4-tert-butyl-2-phenylphenyl) benzoate?
The InChIKey is ZDTXQOSQGGJFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O2.C7H7NO/c1-23(2,3)19-14-15-21(20(16-19)17-10-6-4-7-11-17)25-22(24)18-12-8-5-9-13-18;8-7(9)6-4-2-1-3-5-6/h4-16H,1-3H3;1-5H,(H2,8,9).
What are the key properties of benzamide;(4-tert-butyl-2-phenylphenyl) benzoate?
benzamide;(4-tert-butyl-2-phenylphenyl) benzoate has a molecular weight of 451.57 g/mol, XLogP of 6.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;(4-tert-butyl-2-phenylphenyl) benzoate is sourced from PubChem (CID 146420990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).