C27H30O3 — CID 56612248
[2-(2,4-ditert-butylphenyl)-3-hydroxyphenyl] benzoate (PubChem CID 56612248) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is [2-(2,4-ditert-butylphenyl)-3-hydroxyphenyl] benzoate.
| Compound Name | [2-(2,4-ditert-butylphenyl)-3-hydroxyphenyl] benzoate |
|---|---|
| PubChem CID | 56612248 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [2-(2,4-ditert-butylphenyl)-3-hydroxyphenyl] benzoate |
| SMILES | CC(C)(C)c1ccc(-c2c(O)cccc2OC(=O)c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H30O3/c1-26(2,3)19-15-16-20(21(17-19)27(4,5)6)24-22(28)13-10-14-23(24)30-25(29)18-11-8-7-9-12-18/h7-17,28H,1-6H3 |
| InChIKey | WBUYCZSDGRRUGA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|