C48H54O5 — CID 57112288
(2-phenoxycarbonylphenyl) 3-(2,4-ditert-butylphenyl)-2-(3,5-ditert-butylphenyl)-4-hydroxybenzoate (PubChem CID 57112288) has the molecular formula C48H54O5 and a molecular weight of 710.96 g/mol. Its IUPAC name is (2-phenoxycarbonylphenyl) 3-(2,4-ditert-butylphenyl)-2-(3,5-ditert-butylphenyl)-4-hydroxybenzoate.
| Compound Name | (2-phenoxycarbonylphenyl) 3-(2,4-ditert-butylphenyl)-2-(3,5-ditert-butylphenyl)-4-hydroxybenzoate |
|---|---|
| PubChem CID | 57112288 |
| Molecular Formula | C48H54O5 |
| Molecular Weight | 710.96 g/mol |
| Exact Mass | 710.40 |
| IUPAC Name | (2-phenoxycarbonylphenyl) 3-(2,4-ditert-butylphenyl)-2-(3,5-ditert-butylphenyl)-4-hydroxybenzoate |
| SMILES | CC(C)(C)c1cc(-c2c(C(=O)Oc3ccccc3C(=O)Oc3ccccc3)ccc(O)c2-c2ccc(C(C)(C)C)cc2C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H54O5/c1-45(2,3)31-22-23-35(38(29-31)48(10,11)12)42-39(49)25-24-37(41(42)30-26-32(46(4,5)6)28-33(27-30)47(7,8)9)44(51)53-40-21-17-16-20-36(40)43(50)52-34-18-14-13-15-19-34/h13-29,49H,1-12H3 |
| InChIKey | HEUFJQGVULIFHQ-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.96 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|