C23H19N3 — CID 146421035
4-(9,9-dimethylfluoren-2-yl)quinazolin-2-amine (PubChem CID 146421035) has the molecular formula C23H19N3 and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-2-yl)quinazolin-2-amine.
| Compound Name | 4-(9,9-dimethylfluoren-2-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 146421035 |
| Molecular Formula | C23H19N3 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-(9,9-dimethylfluoren-2-yl)quinazolin-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(N)nc4ccccc34)cc21 |
| InChI | InChI=1S/C23H19N3/c1-23(2)18-9-5-3-7-15(18)16-12-11-14(13-19(16)23)21-17-8-4-6-10-20(17)25-22(24)26-21/h3-13H,1-2H3,(H2,24,25,26) |
| InChIKey | LLRGVIFMGIIHDP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |