C29H21BrN2 — CID 129208486
4-(7-bromo-9,9-dimethylfluoren-2-yl)-2-phenylquinazoline (PubChem CID 129208486) has the molecular formula C29H21BrN2 and a molecular weight of 477.41 g/mol. Its IUPAC name is 4-(7-bromo-9,9-dimethylfluoren-2-yl)-2-phenylquinazoline.
| Compound Name | 4-(7-bromo-9,9-dimethylfluoren-2-yl)-2-phenylquinazoline |
|---|---|
| PubChem CID | 129208486 |
| Molecular Formula | C29H21BrN2 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 4-(7-bromo-9,9-dimethylfluoren-2-yl)-2-phenylquinazoline |
| SMILES | CC1(C)c2cc(Br)ccc2-c2ccc(-c3nc(-c4ccccc4)nc4ccccc34)cc21 |
| InChI | InChI=1S/C29H21BrN2/c1-29(2)24-16-19(12-14-21(24)22-15-13-20(30)17-25(22)29)27-23-10-6-7-11-26(23)31-28(32-27)18-8-4-3-5-9-18/h3-17H,1-2H3 |
| InChIKey | JXFAKFUEYSVTFW-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |