C49H34Br2N4 — CID 158631648
2-(7-bromo-9,9-dimethylfluoren-2-yl)-4-phenylquinazoline;2-(4-bromophenyl)-4-phenylquinazoline (PubChem CID 158631648) has the molecular formula C49H34Br2N4 and a molecular weight of 838.65 g/mol. Its IUPAC name is 2-(7-bromo-9,9-dimethylfluoren-2-yl)-4-phenylquinazoline;2-(4-bromophenyl)-4-phenylquinazoline.
| Compound Name | 2-(7-bromo-9,9-dimethylfluoren-2-yl)-4-phenylquinazoline;2-(4-bromophenyl)-4-phenylquinazoline |
|---|---|
| PubChem CID | 158631648 |
| Molecular Formula | C49H34Br2N4 |
| Molecular Weight | 838.65 g/mol |
| Exact Mass | 836.12 |
| IUPAC Name | 2-(7-bromo-9,9-dimethylfluoren-2-yl)-4-phenylquinazoline;2-(4-bromophenyl)-4-phenylquinazoline |
| SMILES | Brc1ccc(-c2nc(-c3ccccc3)c3ccccc3n2)cc1.CC1(C)c2cc(Br)ccc2-c2ccc(-c3nc(-c4ccccc4)c4ccccc4n3)cc21 |
| InChI | InChI=1S/C29H21BrN2.C20H13BrN2/c1-29(2)24-16-19(12-14-21(24)22-15-13-20(30)17-25(22)29)28-31-26-11-7-6-10-23(26)27(32-28)18-8-4-3-5-9-18;21-16-12-10-15(11-13-16)20-22-18-9-5-4-8-17(18)19(23-20)14-6-2-1-3-7-14/h3-17H,1-2H3;1-13H |
| InChIKey | HZGQSMDMJUCQCR-UHFFFAOYSA-N |
| XLogP | 13.76 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.65 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |