C12H5F5OS — CID 146422717
2,3-difluoro-4-[5-(trifluoromethyl)thiophen-3-yl]benzaldehyde (PubChem CID 146422717) has the molecular formula C12H5F5OS and a molecular weight of 292.23 g/mol. Its IUPAC name is 2,3-difluoro-4-[5-(trifluoromethyl)thiophen-3-yl]benzaldehyde.
| Compound Name | 2,3-difluoro-4-[5-(trifluoromethyl)thiophen-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 146422717 |
| Molecular Formula | C12H5F5OS |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 2,3-difluoro-4-[5-(trifluoromethyl)thiophen-3-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2csc(C(F)(F)F)c2)c(F)c1F |
| InChI | InChI=1S/C12H5F5OS/c13-10-6(4-18)1-2-8(11(10)14)7-3-9(19-5-7)12(15,16)17/h1-5H |
| InChIKey | GVUFLQQWJBFKSR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|