C14H7F2N2OTl — CID 143629701
[6-(2,3-difluoro-4-formylphenyl)benzimidazol-1-yl]thallium (PubChem CID 143629701) has the molecular formula C14H7F2N2OTl and a molecular weight of 461.60 g/mol. Its IUPAC name is [6-(2,3-difluoro-4-formylphenyl)benzimidazol-1-yl]thallium.
| Compound Name | [6-(2,3-difluoro-4-formylphenyl)benzimidazol-1-yl]thallium |
|---|---|
| PubChem CID | 143629701 |
| Molecular Formula | C14H7F2N2OTl |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | [6-(2,3-difluoro-4-formylphenyl)benzimidazol-1-yl]thallium |
| SMILES | O=Cc1ccc(-c2ccc3ncn([Tl])c3c2)c(F)c1F |
| InChI | InChI=1S/C14H8F2N2O.Tl/c15-13-9(6-19)1-3-10(14(13)16)8-2-4-11-12(5-8)18-7-17-11;/h1-7H,(H,17,18,19);/q;+1/p-1 |
| InChIKey | JLIFFXDDYPQJQU-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|