C18H14F3NO — CID 86685273
1-propan-2-yl-5-(2,3,4-trifluorophenyl)indole-3-carbaldehyde (PubChem CID 86685273) has the molecular formula C18H14F3NO and a molecular weight of 317.31 g/mol. Its IUPAC name is 1-propan-2-yl-5-(2,3,4-trifluorophenyl)indole-3-carbaldehyde.
| Compound Name | 1-propan-2-yl-5-(2,3,4-trifluorophenyl)indole-3-carbaldehyde |
|---|---|
| PubChem CID | 86685273 |
| Molecular Formula | C18H14F3NO |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-propan-2-yl-5-(2,3,4-trifluorophenyl)indole-3-carbaldehyde |
| SMILES | CC(C)n1cc(C=O)c2cc(-c3ccc(F)c(F)c3F)ccc21 |
| InChI | InChI=1S/C18H14F3NO/c1-10(2)22-8-12(9-23)14-7-11(3-6-16(14)22)13-4-5-15(19)18(21)17(13)20/h3-10H,1-2H3 |
| InChIKey | LIHNRKVGYNNCMM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|