C18H23N3O2 — CID 146422801
N-[(5-methyl-2-phenylpyrazol-3-yl)oxymethyl]cyclohexanecarboxamide (PubChem CID 146422801) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[(5-methyl-2-phenylpyrazol-3-yl)oxymethyl]cyclohexanecarboxamide.
| Compound Name | N-[(5-methyl-2-phenylpyrazol-3-yl)oxymethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 146422801 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[(5-methyl-2-phenylpyrazol-3-yl)oxymethyl]cyclohexanecarboxamide |
| SMILES | Cc1cc(OCNC(=O)C2CCCCC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H23N3O2/c1-14-12-17(21(20-14)16-10-6-3-7-11-16)23-13-19-18(22)15-8-4-2-5-9-15/h3,6-7,10-12,15H,2,4-5,8-9,13H2,1H3,(H,19,22) |
| InChIKey | GABACKGCZYFOEL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|