C19H24N2O3 — CID 166035459
1-(5-methyl-2-phenylpyrazol-3-yl)oxyethyl cyclohexanecarboxylate (PubChem CID 166035459) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-(5-methyl-2-phenylpyrazol-3-yl)oxyethyl cyclohexanecarboxylate.
| Compound Name | 1-(5-methyl-2-phenylpyrazol-3-yl)oxyethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 166035459 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-(5-methyl-2-phenylpyrazol-3-yl)oxyethyl cyclohexanecarboxylate |
| SMILES | Cc1cc(OC(C)OC(=O)C2CCCCC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H24N2O3/c1-14-13-18(21(20-14)17-11-7-4-8-12-17)23-15(2)24-19(22)16-9-5-3-6-10-16/h4,7-8,11-13,15-16H,3,5-6,9-10H2,1-2H3 |
| InChIKey | FVQKMEXOZGOCPY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|