C23H19F5N2O2S — CID 3654203
[3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] cyclohexanecarboxylate (PubChem CID 3654203) has the molecular formula C23H19F5N2O2S and a molecular weight of 482.47 g/mol. Its IUPAC name is [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] cyclohexanecarboxylate.
| Compound Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 3654203 |
| Molecular Formula | C23H19F5N2O2S |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] cyclohexanecarboxylate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)C2CCCCC2)c1Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H19F5N2O2S/c1-12-20(33-21-18(27)16(25)15(24)17(26)19(21)28)22(30(29-12)14-10-6-3-7-11-14)32-23(31)13-8-4-2-5-9-13/h3,6-7,10-11,13H,2,4-5,8-9H2,1H3 |
| InChIKey | IRFRHKNIDDXEOK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|